C17H20ClNO2 — CID 43078961
1-(3-chlorophenyl)-N-[(3,5-dimethoxyphenyl)methyl]ethanamine (PubChem CID 43078961) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[(3,5-dimethoxyphenyl)methyl]ethanamine.
| Compound Name | 1-(3-chlorophenyl)-N-[(3,5-dimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43078961 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[(3,5-dimethoxyphenyl)methyl]ethanamine |
| SMILES | COc1cc(CNC(C)c2cccc(Cl)c2)cc(OC)c1 |
| InChI | InChI=1S/C17H20ClNO2/c1-12(14-5-4-6-15(18)9-14)19-11-13-7-16(20-2)10-17(8-13)21-3/h4-10,12,19H,11H2,1-3H3 |
| InChIKey | GVWGXIVDLBXQII-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |