C12H19N3 — CID 43080219
N-(2,3-dimethylcyclohexyl)pyrimidin-2-amine (PubChem CID 43080219) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)pyrimidin-2-amine.
| Compound Name | N-(2,3-dimethylcyclohexyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 43080219 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)pyrimidin-2-amine |
| SMILES | CC1CCCC(Nc2ncccn2)C1C |
| InChI | InChI=1S/C12H19N3/c1-9-5-3-6-11(10(9)2)15-12-13-7-4-8-14-12/h4,7-11H,3,5-6H2,1-2H3,(H,13,14,15) |
| InChIKey | ARYXTSKVGWVSFR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |