C20H25N — CID 43081550
1-(2-bicyclo[2.2.1]heptanyl)-N-(naphthalen-1-ylmethyl)ethanamine (PubChem CID 43081550) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-N-(naphthalen-1-ylmethyl)ethanamine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-(naphthalen-1-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 43081550 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-(naphthalen-1-ylmethyl)ethanamine |
| SMILES | CC(NCc1cccc2ccccc12)C1CC2CCC1C2 |
| InChI | InChI=1S/C20H25N/c1-14(20-12-15-9-10-17(20)11-15)21-13-18-7-4-6-16-5-2-3-8-19(16)18/h2-8,14-15,17,20-21H,9-13H2,1H3 |
| InChIKey | INVSGDMBCWAFNG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |