C15H15NO3 — CID 43082666
N-(3-hydroxyphenyl)-2-(2-methoxyphenyl)acetamide (PubChem CID 43082666) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-(3-hydroxyphenyl)-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43082666 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-(3-hydroxyphenyl)-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C15H15NO3/c1-19-14-8-3-2-5-11(14)9-15(18)16-12-6-4-7-13(17)10-12/h2-8,10,17H,9H2,1H3,(H,16,18) |
| InChIKey | FWFGXRBRQMVGMW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |