C12H24N2O — CID 43083458
2-(butylamino)-N-cyclopentylpropanamide (PubChem CID 43083458) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-(butylamino)-N-cyclopentylpropanamide.
| Compound Name | 2-(butylamino)-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 43083458 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-(butylamino)-N-cyclopentylpropanamide |
| SMILES | CCCCNC(C)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C12H24N2O/c1-3-4-9-13-10(2)12(15)14-11-7-5-6-8-11/h10-11,13H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | OEXXJNOTMKCMHS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|