C17H26N2O — CID 43083597
N-cyclohexyl-2-(3,5-dimethylanilino)propanamide (PubChem CID 43083597) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,5-dimethylanilino)propanamide.
| Compound Name | N-cyclohexyl-2-(3,5-dimethylanilino)propanamide |
|---|---|
| PubChem CID | 43083597 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | N-cyclohexyl-2-(3,5-dimethylanilino)propanamide |
| SMILES | Cc1cc(C)cc(NC(C)C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C17H26N2O/c1-12-9-13(2)11-16(10-12)18-14(3)17(20)19-15-7-5-4-6-8-15/h9-11,14-15,18H,4-8H2,1-3H3,(H,19,20) |
| InChIKey | WXVJHIIAPYMQKN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |