C11H11F2N3 — CID 43088131
2,6-difluoro-N-[(1-methylimidazol-2-yl)methyl]aniline (PubChem CID 43088131) has the molecular formula C11H11F2N3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2,6-difluoro-N-[(1-methylimidazol-2-yl)methyl]aniline.
| Compound Name | 2,6-difluoro-N-[(1-methylimidazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 43088131 |
| Molecular Formula | C11H11F2N3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2,6-difluoro-N-[(1-methylimidazol-2-yl)methyl]aniline |
| SMILES | Cn1ccnc1CNc1c(F)cccc1F |
| InChI | InChI=1S/C11H11F2N3/c1-16-6-5-14-10(16)7-15-11-8(12)3-2-4-9(11)13/h2-6,15H,7H2,1H3 |
| InChIKey | VEBLECPPPOMAJI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |