About 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one
1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one (PubChem CID 43088529) has the molecular formula C11H13N5O
and a molecular weight of 231.26 g/mol. Its IUPAC name is 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one.
Molecular Properties
| Compound Name | 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one |
| PubChem CID | 43088529 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one |
| SMILES | Cn1ncc2c(N3CCC(=O)CC3)ncnc21 |
| InChI | InChI=1S/C11H13N5O/c1-15-10-9(6-14-15)11(13-7-12-10)16-4-2-8(17)3-5-16/h6-7H,2-5H2,1H3 |
| InChIKey | COCDJBVRWYLHPU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one?
The IUPAC name of 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one (CID 43088529) is 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one.
What is the SMILES notation for 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one?
The canonical SMILES for 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one is Cn1ncc2c(N3CCC(=O)CC3)ncnc21.
What is the InChIKey of 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one?
The InChIKey is COCDJBVRWYLHPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O/c1-15-10-9(6-14-15)11(13-7-12-10)16-4-2-8(17)3-5-16/h6-7H,2-5H2,1H3.
What are the key properties of 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one?
1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one has a molecular weight of 231.26 g/mol, XLogP of 0.53, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-one is sourced from PubChem (CID 43088529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).