C11H18F2N4O — CID 43088545
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-morpholin-4-ylethanamine (PubChem CID 43088545) has the molecular formula C11H18F2N4O and a molecular weight of 260.29 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 43088545 |
| Molecular Formula | C11H18F2N4O |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-morpholin-4-ylethanamine |
| SMILES | FC(F)n1ccnc1CNCCN1CCOCC1 |
| InChI | InChI=1S/C11H18F2N4O/c12-11(13)17-4-2-15-10(17)9-14-1-3-16-5-7-18-8-6-16/h2,4,11,14H,1,3,5-9H2 |
| InChIKey | DICBSEUDNZWELB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|