About N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine
N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine (PubChem CID 43089142) has the molecular formula C15H22N2S
and a molecular weight of 262.42 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine.
Molecular Properties
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine |
| PubChem CID | 43089142 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine |
| SMILES | CCCCCCCNCc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H22N2S/c1-2-3-4-5-8-11-16-12-15-17-13-9-6-7-10-14(13)18-15/h6-7,9-10,16H,2-5,8,11-12H2,1H3 |
| InChIKey | YASMLGAKRCXRLS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine?
The IUPAC name of N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine (CID 43089142) is N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine.
What is the SMILES notation for N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine?
The canonical SMILES for N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine is CCCCCCCNCc1nc2ccccc2s1.
What is the InChIKey of N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine?
The InChIKey is YASMLGAKRCXRLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2S/c1-2-3-4-5-8-11-16-12-15-17-13-9-6-7-10-14(13)18-15/h6-7,9-10,16H,2-5,8,11-12H2,1H3.
What are the key properties of N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine?
N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine has a molecular weight of 262.42 g/mol, XLogP of 4.36, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzothiazol-2-ylmethyl)heptan-1-amine is sourced from PubChem (CID 43089142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).