C10H17F3N2O — CID 43089163
N-cyclopentyl-2-(2,2,2-trifluoroethylamino)propanamide (PubChem CID 43089163) has the molecular formula C10H17F3N2O and a molecular weight of 238.25 g/mol. Its IUPAC name is N-cyclopentyl-2-(2,2,2-trifluoroethylamino)propanamide.
| Compound Name | N-cyclopentyl-2-(2,2,2-trifluoroethylamino)propanamide |
|---|---|
| PubChem CID | 43089163 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-cyclopentyl-2-(2,2,2-trifluoroethylamino)propanamide |
| SMILES | CC(NCC(F)(F)F)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C10H17F3N2O/c1-7(14-6-10(11,12)13)9(16)15-8-4-2-3-5-8/h7-8,14H,2-6H2,1H3,(H,15,16) |
| InChIKey | WJLKCDVLOVCJDP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |