About N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide
N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide (PubChem CID 43089171) has the molecular formula C8H15F3N2O
and a molecular weight of 212.21 g/mol. Its IUPAC name is N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide.
Molecular Properties
| Compound Name | N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide |
| PubChem CID | 43089171 |
| Molecular Formula | C8H15F3N2O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide |
| SMILES | CC(C)NC(=O)C(C)NCC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O/c1-5(2)13-7(14)6(3)12-4-8(9,10)11/h5-6,12H,4H2,1-3H3,(H,13,14) |
| InChIKey | DUHYUZVZCVISFE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 41.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 192 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide?
The IUPAC name of N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide (CID 43089171) is N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide.
What is the SMILES notation for N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide?
The canonical SMILES for N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide is CC(C)NC(=O)C(C)NCC(F)(F)F.
What is the InChIKey of N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide?
The InChIKey is DUHYUZVZCVISFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O/c1-5(2)13-7(14)6(3)12-4-8(9,10)11/h5-6,12H,4H2,1-3H3,(H,13,14).
What are the key properties of N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide?
N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide has a molecular weight of 212.21 g/mol, XLogP of 1.50, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-2-(2,2,2-trifluoroethylamino)propanamide is sourced from PubChem (CID 43089171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).