C11H14N4O2 — CID 43090469
2-(furan-2-yl)-5-(piperazin-1-ylmethyl)-1,3,4-oxadiazole (PubChem CID 43090469) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-(piperazin-1-ylmethyl)-1,3,4-oxadiazole.
| Compound Name | 2-(furan-2-yl)-5-(piperazin-1-ylmethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 43090469 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-(furan-2-yl)-5-(piperazin-1-ylmethyl)-1,3,4-oxadiazole |
| SMILES | c1coc(-c2nnc(CN3CCNCC3)o2)c1 |
| InChI | InChI=1S/C11H14N4O2/c1-2-9(16-7-1)11-14-13-10(17-11)8-15-5-3-12-4-6-15/h1-2,7,12H,3-6,8H2 |
| InChIKey | TWLHCZLYWVOLJZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |