About N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine
N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine (PubChem CID 43090889) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine |
| PubChem CID | 43090889 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine |
| SMILES | COc1cc(OC)c(CNC(C)C)c(OC)c1 |
| InChI | InChI=1S/C13H21NO3/c1-9(2)14-8-11-12(16-4)6-10(15-3)7-13(11)17-5/h6-7,9,14H,8H2,1-5H3 |
| InChIKey | LJFNGEFTSQSRHR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine?
The IUPAC name of N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine (CID 43090889) is N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine.
What is the SMILES notation for N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine?
The canonical SMILES for N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine is COc1cc(OC)c(CNC(C)C)c(OC)c1.
What is the InChIKey of N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine?
The InChIKey is LJFNGEFTSQSRHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3/c1-9(2)14-8-11-12(16-4)6-10(15-3)7-13(11)17-5/h6-7,9,14H,8H2,1-5H3.
What are the key properties of N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine?
N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine has a molecular weight of 239.31 g/mol, XLogP of 2.21, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4,6-trimethoxyphenyl)methyl]propan-2-amine is sourced from PubChem (CID 43090889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).