C12H18N2O — CID 43091089
2,3,4,5,6-pentamethylbenzohydrazide (PubChem CID 43091089) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethylbenzohydrazide.
| Compound Name | 2,3,4,5,6-pentamethylbenzohydrazide |
|---|---|
| PubChem CID | 43091089 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2,3,4,5,6-pentamethylbenzohydrazide |
| SMILES | Cc1c(C)c(C)c(C(=O)NN)c(C)c1C |
| InChI | InChI=1S/C12H18N2O/c1-6-7(2)9(4)11(12(15)14-13)10(5)8(6)3/h13H2,1-5H3,(H,14,15) |
| InChIKey | AJTIVRITQAYVSM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|