C8H8N6O — CID 43091169
4-(2H-tetrazol-5-yl)benzohydrazide (PubChem CID 43091169) has the molecular formula C8H8N6O and a molecular weight of 204.19 g/mol. Its IUPAC name is 4-(2H-tetrazol-5-yl)benzohydrazide.
| Compound Name | 4-(2H-tetrazol-5-yl)benzohydrazide |
|---|---|
| PubChem CID | 43091169 |
| Molecular Formula | C8H8N6O |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 4-(2H-tetrazol-5-yl)benzohydrazide |
| SMILES | NNC(=O)c1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C8H8N6O/c9-10-8(15)6-3-1-5(2-4-6)7-11-13-14-12-7/h1-4H,9H2,(H,10,15)(H,11,12,13,14) |
| InChIKey | CCKNKILAFRZWPA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|