About 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide
2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide (PubChem CID 43091254) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
| PubChem CID | 43091254 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
| SMILES | Cc1cn2c(CC(N)=O)csc2n1 |
| InChI | InChI=1S/C8H9N3OS/c1-5-3-11-6(2-7(9)12)4-13-8(11)10-5/h3-4H,2H2,1H3,(H2,9,12) |
| InChIKey | DCGVPAZUBQXYPZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide?
The IUPAC name of 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide (CID 43091254) is 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide.
What is the SMILES notation for 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide?
The canonical SMILES for 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide is Cc1cn2c(CC(N)=O)csc2n1.
What is the InChIKey of 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide?
The InChIKey is DCGVPAZUBQXYPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-5-3-11-6(2-7(9)12)4-13-8(11)10-5/h3-4H,2H2,1H3,(H2,9,12).
What are the key properties of 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide?
2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide has a molecular weight of 195.25 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide is sourced from PubChem (CID 43091254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).