About 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid
3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid (PubChem CID 43092733) has the molecular formula C8H11NO5S
and a molecular weight of 233.24 g/mol. Its IUPAC name is 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid.
Molecular Properties
| Compound Name | 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid |
| PubChem CID | 43092733 |
| Molecular Formula | C8H11NO5S |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCSCC(=O)N1CCOC1=O |
| InChI | InChI=1S/C8H11NO5S/c10-6(5-15-4-1-7(11)12)9-2-3-14-8(9)13/h1-5H2,(H,11,12) |
| InChIKey | KGQLLDUXYQYAPU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid?
The IUPAC name of 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid (CID 43092733) is 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid.
What is the SMILES notation for 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid?
The canonical SMILES for 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid is O=C(O)CCSCC(=O)N1CCOC1=O.
What is the InChIKey of 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid?
The InChIKey is KGQLLDUXYQYAPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO5S/c10-6(5-15-4-1-7(11)12)9-2-3-14-8(9)13/h1-5H2,(H,11,12).
What are the key properties of 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid?
3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid has a molecular weight of 233.24 g/mol, XLogP of 0.17, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]sulfanylpropanoic acid is sourced from PubChem (CID 43092733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).