C18H24N2O6 — CID 4309380
2-methoxyethyl N-(1,3-benzodioxole-5-carbonyl)-2,6-dimethylmorpholine-4-carboximidate (PubChem CID 4309380) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-methoxyethyl N-(1,3-benzodioxole-5-carbonyl)-2,6-dimethylmorpholine-4-carboximidate.
| Compound Name | 2-methoxyethyl N-(1,3-benzodioxole-5-carbonyl)-2,6-dimethylmorpholine-4-carboximidate |
|---|---|
| PubChem CID | 4309380 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-methoxyethyl N-(1,3-benzodioxole-5-carbonyl)-2,6-dimethylmorpholine-4-carboximidate |
| SMILES | COCCO/C(=N\C(=O)c1ccc2c(c1)OCO2)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C18H24N2O6/c1-12-9-20(10-13(2)26-12)18(23-7-6-22-3)19-17(21)14-4-5-15-16(8-14)25-11-24-15/h4-5,8,12-13H,6-7,9-11H2,1-3H3/b19-18- |
| InChIKey | JRVPVKRVMXXKNL-HNENSFHCSA-N |
| XLogP | 1.68 |
| TPSA | 78.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|