C14H11Cl2N5O3 — CID 4309402
5-N-(2,5-dichlorophenyl)-7-N-ethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine (PubChem CID 4309402) has the molecular formula C14H11Cl2N5O3 and a molecular weight of 368.18 g/mol. Its IUPAC name is 5-N-(2,5-dichlorophenyl)-7-N-ethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine.
| Compound Name | 5-N-(2,5-dichlorophenyl)-7-N-ethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine |
|---|---|
| PubChem CID | 4309402 |
| Molecular Formula | C14H11Cl2N5O3 |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 5-N-(2,5-dichlorophenyl)-7-N-ethyl-4-nitro-2,1,3-benzoxadiazole-5,7-diamine |
| SMILES | CCNc1cc(Nc2cc(Cl)ccc2Cl)c([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C14H11Cl2N5O3/c1-2-17-10-6-11(18-9-5-7(15)3-4-8(9)16)14(21(22)23)13-12(10)19-24-20-13/h3-6,17-18H,2H2,1H3 |
| InChIKey | JXJUVFOTLVDKCY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|