C24H23N3O2 — CID 4309791
4-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 4309791) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | 4-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 4309791 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-[[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | CCc1ccccc1-n1c(C)cc(C=C2C(=O)NN(c3ccccc3)C2=O)c1C |
| InChI | InChI=1S/C24H23N3O2/c1-4-18-10-8-9-13-22(18)26-16(2)14-19(17(26)3)15-21-23(28)25-27(24(21)29)20-11-6-5-7-12-20/h5-15H,4H2,1-3H3,(H,25,28) |
| InChIKey | MLSXTLNRHPREJW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|