About bis(pyridine-2,6-dicarboxylic acid);zinc
bis(pyridine-2,6-dicarboxylic acid);zinc (PubChem CID 4309911) has the molecular formula C14H10N2O8Zn
and a molecular weight of 399.63 g/mol. Its IUPAC name is bis(pyridine-2,6-dicarboxylic acid);zinc.
Molecular Properties
| Compound Name | bis(pyridine-2,6-dicarboxylic acid);zinc |
| PubChem CID | 4309911 |
| Molecular Formula | C14H10N2O8Zn |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | bis(pyridine-2,6-dicarboxylic acid);zinc |
| SMILES | O=C(O)c1cccc(C(=O)O)n1.O=C(O)c1cccc(C(=O)O)n1.[Zn] |
| InChI | InChI=1S/2C7H5NO4.Zn/c2*9-6(10)4-2-1-3-5(8-4)7(11)12;/h2*1-3H,(H,9,10)(H,11,12); |
| InChIKey | NKQJACUSMKXTKC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 174.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(pyridine-2,6-dicarboxylic acid);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(pyridine-2,6-dicarboxylic acid);zinc?
The IUPAC name of bis(pyridine-2,6-dicarboxylic acid);zinc (CID 4309911) is bis(pyridine-2,6-dicarboxylic acid);zinc.
What is the SMILES notation for bis(pyridine-2,6-dicarboxylic acid);zinc?
The canonical SMILES for bis(pyridine-2,6-dicarboxylic acid);zinc is O=C(O)c1cccc(C(=O)O)n1.O=C(O)c1cccc(C(=O)O)n1.[Zn].
What is the InChIKey of bis(pyridine-2,6-dicarboxylic acid);zinc?
The InChIKey is NKQJACUSMKXTKC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H5NO4.Zn/c2*9-6(10)4-2-1-3-5(8-4)7(11)12;/h2*1-3H,(H,9,10)(H,11,12);.
What are the key properties of bis(pyridine-2,6-dicarboxylic acid);zinc?
bis(pyridine-2,6-dicarboxylic acid);zinc has a molecular weight of 399.63 g/mol, XLogP of 0.95, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(pyridine-2,6-dicarboxylic acid);zinc is sourced from PubChem (CID 4309911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).