C19H23NO — CID 43100217
2-(5-methyl-2-propan-2-ylphenoxy)-2,3-dihydro-1H-inden-1-amine (PubChem CID 43100217) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-ylphenoxy)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 2-(5-methyl-2-propan-2-ylphenoxy)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 43100217 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylphenoxy)-2,3-dihydro-1H-inden-1-amine |
| SMILES | Cc1ccc(C(C)C)c(OC2Cc3ccccc3C2N)c1 |
| InChI | InChI=1S/C19H23NO/c1-12(2)15-9-8-13(3)10-17(15)21-18-11-14-6-4-5-7-16(14)19(18)20/h4-10,12,18-19H,11,20H2,1-3H3 |
| InChIKey | JHLLVZDPBKDBEM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |