C16H21BrFN — CID 43100719
1-(2-bicyclo[2.2.1]heptanyl)-N-[(2-bromo-5-fluorophenyl)methyl]ethanamine (PubChem CID 43100719) has the molecular formula C16H21BrFN and a molecular weight of 326.25 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-N-[(2-bromo-5-fluorophenyl)methyl]ethanamine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-[(2-bromo-5-fluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43100719 |
| Molecular Formula | C16H21BrFN |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-[(2-bromo-5-fluorophenyl)methyl]ethanamine |
| SMILES | CC(NCc1cc(F)ccc1Br)C1CC2CCC1C2 |
| InChI | InChI=1S/C16H21BrFN/c1-10(15-7-11-2-3-12(15)6-11)19-9-13-8-14(18)4-5-16(13)17/h4-5,8,10-12,15,19H,2-3,6-7,9H2,1H3 |
| InChIKey | NCEOHQWDKJPTPO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |