About 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine
3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine (PubChem CID 43101148) has the molecular formula C17H25F2NO
and a molecular weight of 297.39 g/mol. Its IUPAC name is 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine |
| PubChem CID | 43101148 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine |
| SMILES | CC(NCCCOC1CCCCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H25F2NO/c1-13(16-9-8-14(18)12-17(16)19)20-10-5-11-21-15-6-3-2-4-7-15/h8-9,12-13,15,20H,2-7,10-11H2,1H3 |
| InChIKey | NNGYRCKWRVJREF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine?
The IUPAC name of 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine (CID 43101148) is 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine.
What is the SMILES notation for 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine?
The canonical SMILES for 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine is CC(NCCCOC1CCCCC1)c1ccc(F)cc1F.
What is the InChIKey of 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine?
The InChIKey is NNGYRCKWRVJREF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F2NO/c1-13(16-9-8-14(18)12-17(16)19)20-10-5-11-21-15-6-3-2-4-7-15/h8-9,12-13,15,20H,2-7,10-11H2,1H3.
What are the key properties of 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine?
3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine has a molecular weight of 297.39 g/mol, XLogP of 4.35, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyloxy-N-[1-(2,4-difluorophenyl)ethyl]propan-1-amine is sourced from PubChem (CID 43101148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).