About [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea
[(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea (PubChem CID 4310243) has the molecular formula C9H15N5O2S
and a molecular weight of 257.32 g/mol. Its IUPAC name is [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea.
Molecular Properties
| Compound Name | [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea |
| PubChem CID | 4310243 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea |
| SMILES | CCCCC1(C=NNC(N)=S)NC(=O)NC1=O |
| InChI | InChI=1S/C9H15N5O2S/c1-2-3-4-9(5-11-14-7(10)17)6(15)12-8(16)13-9/h5H,2-4H2,1H3,(H3,10,14,17)(H2,12,13,15,16) |
| InChIKey | YTKWGTJWXCPKBB-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea?
The IUPAC name of [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea (CID 4310243) is [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea.
What is the SMILES notation for [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea?
The canonical SMILES for [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea is CCCCC1(C=NNC(N)=S)NC(=O)NC1=O.
What is the InChIKey of [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea?
The InChIKey is YTKWGTJWXCPKBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O2S/c1-2-3-4-9(5-11-14-7(10)17)6(15)12-8(16)13-9/h5H,2-4H2,1H3,(H3,10,14,17)(H2,12,13,15,16).
What are the key properties of [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea?
[(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea has a molecular weight of 257.32 g/mol, XLogP of -0.43, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-butyl-2,5-dioxoimidazolidin-4-yl)methylideneamino]thiourea is sourced from PubChem (CID 4310243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).