About 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline
2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline (PubChem CID 43103408) has the molecular formula C15H15ClF3NS
and a molecular weight of 333.81 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline |
| PubChem CID | 43103408 |
| Molecular Formula | C15H15ClF3NS |
| Molecular Weight | 333.81 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline |
| SMILES | Cc1cc(C(C)Nc2cc(C(F)(F)F)ccc2Cl)c(C)s1 |
| InChI | InChI=1S/C15H15ClF3NS/c1-8-6-12(10(3)21-8)9(2)20-14-7-11(15(17,18)19)4-5-13(14)16/h4-7,9,20H,1-3H3 |
| InChIKey | CUMVGQBIAUDUMO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.81 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline?
The IUPAC name of 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline (CID 43103408) is 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline.
What is the SMILES notation for 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline?
The canonical SMILES for 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline is Cc1cc(C(C)Nc2cc(C(F)(F)F)ccc2Cl)c(C)s1.
What is the InChIKey of 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline?
The InChIKey is CUMVGQBIAUDUMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClF3NS/c1-8-6-12(10(3)21-8)9(2)20-14-7-11(15(17,18)19)4-5-13(14)16/h4-7,9,20H,1-3H3.
What are the key properties of 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline?
2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline has a molecular weight of 333.81 g/mol, XLogP of 6.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-5-(trifluoromethyl)aniline is sourced from PubChem (CID 43103408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).