C19H19NO — CID 43103663
N-[furan-2-yl(phenyl)methyl]-2,4-dimethylaniline (PubChem CID 43103663) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is N-[furan-2-yl(phenyl)methyl]-2,4-dimethylaniline.
| Compound Name | N-[furan-2-yl(phenyl)methyl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 43103663 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[furan-2-yl(phenyl)methyl]-2,4-dimethylaniline |
| SMILES | Cc1ccc(NC(c2ccccc2)c2ccco2)c(C)c1 |
| InChI | InChI=1S/C19H19NO/c1-14-10-11-17(15(2)13-14)20-19(18-9-6-12-21-18)16-7-4-3-5-8-16/h3-13,19-20H,1-2H3 |
| InChIKey | VRYVLWWGMASLBB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |