About 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one
4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one (PubChem CID 4310513) has the molecular formula C4H8N6O
and a molecular weight of 156.15 g/mol. Its IUPAC name is 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one |
| PubChem CID | 4310513 |
| Molecular Formula | C4H8N6O |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(NN)n(N)c1=O |
| InChI | InChI=1S/C4H8N6O/c1-2-3(11)10(6)4(7-5)9-8-2/h5-6H2,1H3,(H,7,9) |
| InChIKey | KFFPBWZQPPESLP-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one?
The IUPAC name of 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one (CID 4310513) is 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one.
What is the SMILES notation for 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one?
The canonical SMILES for 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one is Cc1nnc(NN)n(N)c1=O.
What is the InChIKey of 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one?
The InChIKey is KFFPBWZQPPESLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N6O/c1-2-3(11)10(6)4(7-5)9-8-2/h5-6H2,1H3,(H,7,9).
What are the key properties of 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one?
4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one has a molecular weight of 156.15 g/mol, XLogP of -2.05, 1 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-hydrazinyl-6-methyl-1,2,4-triazin-5-one is sourced from PubChem (CID 4310513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).