C10H13N3O6S — CID 43105233
4-methylsulfonyl-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]butanoic acid (PubChem CID 43105233) has the molecular formula C10H13N3O6S and a molecular weight of 303.30 g/mol. Its IUPAC name is 4-methylsulfonyl-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]butanoic acid.
| Compound Name | 4-methylsulfonyl-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43105233 |
| Molecular Formula | C10H13N3O6S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 4-methylsulfonyl-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]butanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)c1c[nH]c(=O)cn1)C(=O)O |
| InChI | InChI=1S/C10H13N3O6S/c1-20(18,19)3-2-6(10(16)17)13-9(15)7-4-12-8(14)5-11-7/h4-6H,2-3H2,1H3,(H,12,14)(H,13,15)(H,16,17) |
| InChIKey | IVXMIBIOIBARLC-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |