About 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine
2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine (PubChem CID 43105752) has the molecular formula C12H15F2NO2
and a molecular weight of 243.25 g/mol. Its IUPAC name is 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine.
Molecular Properties
| Compound Name | 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine |
| PubChem CID | 43105752 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine |
| SMILES | CC(C)C(C)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C12H15F2NO2/c1-7(2)8(3)15-9-4-5-10-11(6-9)17-12(13,14)16-10/h4-8,15H,1-3H3 |
| InChIKey | PYZGDXANBXHFNG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine?
The IUPAC name of 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine (CID 43105752) is 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine.
What is the SMILES notation for 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine?
The canonical SMILES for 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine is CC(C)C(C)Nc1ccc2c(c1)OC(F)(F)O2.
What is the InChIKey of 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine?
The InChIKey is PYZGDXANBXHFNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2NO2/c1-7(2)8(3)15-9-4-5-10-11(6-9)17-12(13,14)16-10/h4-8,15H,1-3H3.
What are the key properties of 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine?
2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine has a molecular weight of 243.25 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-N-(3-methylbutan-2-yl)-1,3-benzodioxol-5-amine is sourced from PubChem (CID 43105752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).