C14H12Cl3N — CID 43106074
3,5-dichloro-N-[1-(3-chlorophenyl)ethyl]aniline (PubChem CID 43106074) has the molecular formula C14H12Cl3N and a molecular weight of 300.62 g/mol. Its IUPAC name is 3,5-dichloro-N-[1-(3-chlorophenyl)ethyl]aniline.
| Compound Name | 3,5-dichloro-N-[1-(3-chlorophenyl)ethyl]aniline |
|---|---|
| PubChem CID | 43106074 |
| Molecular Formula | C14H12Cl3N |
| Molecular Weight | 300.62 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 3,5-dichloro-N-[1-(3-chlorophenyl)ethyl]aniline |
| SMILES | CC(Nc1cc(Cl)cc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H12Cl3N/c1-9(10-3-2-4-11(15)5-10)18-14-7-12(16)6-13(17)8-14/h2-9,18H,1H3 |
| InChIKey | OMYYVMCIPGZFNW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |