C15H17N3O2S — CID 43106636
5-[1-(5-methylthiophen-2-yl)ethylamino]benzene-1,3-dicarboxamide (PubChem CID 43106636) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 5-[1-(5-methylthiophen-2-yl)ethylamino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[1-(5-methylthiophen-2-yl)ethylamino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 43106636 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 5-[1-(5-methylthiophen-2-yl)ethylamino]benzene-1,3-dicarboxamide |
| SMILES | Cc1ccc(C(C)Nc2cc(C(N)=O)cc(C(N)=O)c2)s1 |
| InChI | InChI=1S/C15H17N3O2S/c1-8-3-4-13(21-8)9(2)18-12-6-10(14(16)19)5-11(7-12)15(17)20/h3-7,9,18H,1-2H3,(H2,16,19)(H2,17,20) |
| InChIKey | KVCSLWSFHDFZKO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |