C14H20N2O4S — CID 43107263
3-methyl-2-[(2-methylpiperidin-1-yl)sulfonylamino]benzoic acid (PubChem CID 43107263) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-methyl-2-[(2-methylpiperidin-1-yl)sulfonylamino]benzoic acid.
| Compound Name | 3-methyl-2-[(2-methylpiperidin-1-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 43107263 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-methyl-2-[(2-methylpiperidin-1-yl)sulfonylamino]benzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1NS(=O)(=O)N1CCCCC1C |
| InChI | InChI=1S/C14H20N2O4S/c1-10-6-5-8-12(14(17)18)13(10)15-21(19,20)16-9-4-3-7-11(16)2/h5-6,8,11,15H,3-4,7,9H2,1-2H3,(H,17,18) |
| InChIKey | JMJMASCIXRLZLI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |