C18H16N2O — CID 4310916
4-phenyl-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one (PubChem CID 4310916) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-phenyl-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one.
| Compound Name | 4-phenyl-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one |
|---|---|
| PubChem CID | 4310916 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-phenyl-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one |
| SMILES | O=C1NC2=C(CCc3ccccc32)C(c2ccccc2)N1 |
| InChI | InChI=1S/C18H16N2O/c21-18-19-16(13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)17(15)20-18/h1-9,16H,10-11H2,(H2,19,20,21) |
| InChIKey | KJJLLGKZUIVHTE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |