C16H30N2S — CID 43109467
N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-7-methyloctan-1-amine (PubChem CID 43109467) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-7-methyloctan-1-amine.
| Compound Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-7-methyloctan-1-amine |
|---|---|
| PubChem CID | 43109467 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-7-methyloctan-1-amine |
| SMILES | Cc1nc(C(C)NCCCCCCC(C)C)c(C)s1 |
| InChI | InChI=1S/C16H30N2S/c1-12(2)10-8-6-7-9-11-17-13(3)16-14(4)19-15(5)18-16/h12-13,17H,6-11H2,1-5H3 |
| InChIKey | JAGYCEWDJYFDGJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|