C15H19FN4S — CID 43109627
1-[5-fluoro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)phenyl]ethanamine (PubChem CID 43109627) has the molecular formula C15H19FN4S and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[5-fluoro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)phenyl]ethanamine.
| Compound Name | 1-[5-fluoro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 43109627 |
| Molecular Formula | C15H19FN4S |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 1-[5-fluoro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)phenyl]ethanamine |
| SMILES | CC(N)c1cc(F)ccc1Sc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C15H19FN4S/c1-10(17)12-9-11(16)6-7-13(12)21-15-19-18-14-5-3-2-4-8-20(14)15/h6-7,9-10H,2-5,8,17H2,1H3 |
| InChIKey | UQBHXHANCZBGPX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |