C14H23N — CID 43110036
2-methyl-N-[(3-methylphenyl)methyl]pentan-1-amine (PubChem CID 43110036) has the molecular formula C14H23N and a molecular weight of 205.35 g/mol. Its IUPAC name is 2-methyl-N-[(3-methylphenyl)methyl]pentan-1-amine.
| Compound Name | 2-methyl-N-[(3-methylphenyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 43110036 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 2-methyl-N-[(3-methylphenyl)methyl]pentan-1-amine |
| SMILES | CCCC(C)CNCc1cccc(C)c1 |
| InChI | InChI=1S/C14H23N/c1-4-6-13(3)10-15-11-14-8-5-7-12(2)9-14/h5,7-9,13,15H,4,6,10-11H2,1-3H3 |
| InChIKey | KWQIYQBQNOAGMN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |