C13H29N — CID 43110369
N-butan-2-yl-2,6-dimethylheptan-4-amine (PubChem CID 43110369) has the molecular formula C13H29N and a molecular weight of 199.38 g/mol. Its IUPAC name is N-butan-2-yl-2,6-dimethylheptan-4-amine.
| Compound Name | N-butan-2-yl-2,6-dimethylheptan-4-amine |
|---|---|
| PubChem CID | 43110369 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | N-butan-2-yl-2,6-dimethylheptan-4-amine |
| SMILES | CCC(C)NC(CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H29N/c1-7-12(6)14-13(8-10(2)3)9-11(4)5/h10-14H,7-9H2,1-6H3 |
| InChIKey | CXJBLHCGOXITLL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |