C11H13Cl2N — CID 43110972
3,4-dichloro-N-(1-cyclopropylethyl)aniline (PubChem CID 43110972) has the molecular formula C11H13Cl2N and a molecular weight of 230.14 g/mol. Its IUPAC name is 3,4-dichloro-N-(1-cyclopropylethyl)aniline.
| Compound Name | 3,4-dichloro-N-(1-cyclopropylethyl)aniline |
|---|---|
| PubChem CID | 43110972 |
| Molecular Formula | C11H13Cl2N |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 3,4-dichloro-N-(1-cyclopropylethyl)aniline |
| SMILES | CC(Nc1ccc(Cl)c(Cl)c1)C1CC1 |
| InChI | InChI=1S/C11H13Cl2N/c1-7(8-2-3-8)14-9-4-5-10(12)11(13)6-9/h4-8,14H,2-3H2,1H3 |
| InChIKey | FGLXLJHGSXGKSU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |