C12H9BrN2O2 — CID 43111877
N-(2-bromophenyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 43111877) has the molecular formula C12H9BrN2O2 and a molecular weight of 293.12 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-bromophenyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43111877 |
| Molecular Formula | C12H9BrN2O2 |
| Molecular Weight | 293.12 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | N-(2-bromophenyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)c1ccc[nH]c1=O |
| InChI | InChI=1S/C12H9BrN2O2/c13-9-5-1-2-6-10(9)15-12(17)8-4-3-7-14-11(8)16/h1-7H,(H,14,16)(H,15,17) |
| InChIKey | HQCFAWLRBCACRY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.12 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |