C12H26N2O — CID 43112967
2-(butylamino)-N-(3-methylbutyl)propanamide (PubChem CID 43112967) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-(butylamino)-N-(3-methylbutyl)propanamide.
| Compound Name | 2-(butylamino)-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 43112967 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 2-(butylamino)-N-(3-methylbutyl)propanamide |
| SMILES | CCCCNC(C)C(=O)NCCC(C)C |
| InChI | InChI=1S/C12H26N2O/c1-5-6-8-13-11(4)12(15)14-9-7-10(2)3/h10-11,13H,5-9H2,1-4H3,(H,14,15) |
| InChIKey | UGUZZMUWGFBJCA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|