C12H18N2O — CID 43114423
N-(4-aminophenyl)-N,2-dimethylbutanamide (PubChem CID 43114423) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-(4-aminophenyl)-N,2-dimethylbutanamide.
| Compound Name | N-(4-aminophenyl)-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 43114423 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-(4-aminophenyl)-N,2-dimethylbutanamide |
| SMILES | CCC(C)C(=O)N(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H18N2O/c1-4-9(2)12(15)14(3)11-7-5-10(13)6-8-11/h5-9H,4,13H2,1-3H3 |
| InChIKey | UKJONCVZTQXHOT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|