About (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine
(4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine (PubChem CID 43115259) has the molecular formula C9H10FNS
and a molecular weight of 183.25 g/mol. Its IUPAC name is (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine.
Molecular Properties
| Compound Name | (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine |
| PubChem CID | 43115259 |
| Molecular Formula | C9H10FNS |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine |
| SMILES | NCC1Cc2c(F)cccc2S1 |
| InChI | InChI=1S/C9H10FNS/c10-8-2-1-3-9-7(8)4-6(5-11)12-9/h1-3,6H,4-5,11H2 |
| InChIKey | HPDNTTKECZIDPN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine?
The IUPAC name of (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine (CID 43115259) is (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine.
What is the SMILES notation for (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine?
The canonical SMILES for (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine is NCC1Cc2c(F)cccc2S1.
What is the InChIKey of (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine?
The InChIKey is HPDNTTKECZIDPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNS/c10-8-2-1-3-9-7(8)4-6(5-11)12-9/h1-3,6H,4-5,11H2.
What are the key properties of (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine?
(4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine has a molecular weight of 183.25 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-2,3-dihydro-1-benzothiophen-2-yl)methanamine is sourced from PubChem (CID 43115259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).