C12H12BrN3 — CID 43115534
4-bromo-1-N-(pyridin-3-ylmethyl)benzene-1,2-diamine (PubChem CID 43115534) has the molecular formula C12H12BrN3 and a molecular weight of 278.15 g/mol. Its IUPAC name is 4-bromo-1-N-(pyridin-3-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-(pyridin-3-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 43115534 |
| Molecular Formula | C12H12BrN3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 4-bromo-1-N-(pyridin-3-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(Br)ccc1NCc1cccnc1 |
| InChI | InChI=1S/C12H12BrN3/c13-10-3-4-12(11(14)6-10)16-8-9-2-1-5-15-7-9/h1-7,16H,8,14H2 |
| InChIKey | UYSPRHQRUUDFFP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|