About 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide
2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide (PubChem CID 43116774) has the molecular formula C9H15N5O2
and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide.
Molecular Properties
| Compound Name | 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide |
| PubChem CID | 43116774 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide |
| SMILES | Cc1nn(C(C)C(=O)NC(N)=O)c(C)c1N |
| InChI | InChI=1S/C9H15N5O2/c1-4-7(10)5(2)14(13-4)6(3)8(15)12-9(11)16/h6H,10H2,1-3H3,(H3,11,12,15,16) |
| InChIKey | KMGHQPBCOJFPBY-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide?
The IUPAC name of 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide (CID 43116774) is 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide.
What is the SMILES notation for 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide?
The canonical SMILES for 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide is Cc1nn(C(C)C(=O)NC(N)=O)c(C)c1N.
What is the InChIKey of 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide?
The InChIKey is KMGHQPBCOJFPBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O2/c1-4-7(10)5(2)14(13-4)6(3)8(15)12-9(11)16/h6H,10H2,1-3H3,(H3,11,12,15,16).
What are the key properties of 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide?
2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide has a molecular weight of 225.25 g/mol, XLogP of -0.16, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-3,5-dimethylpyrazol-1-yl)-N-carbamoylpropanamide is sourced from PubChem (CID 43116774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).