C15H22N2O2S — CID 43116981
2-[4-(2-amino-2-sulfanylideneethyl)phenoxy]-N-(2-methylpropyl)propanamide (PubChem CID 43116981) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[4-(2-amino-2-sulfanylideneethyl)phenoxy]-N-(2-methylpropyl)propanamide.
| Compound Name | 2-[4-(2-amino-2-sulfanylideneethyl)phenoxy]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 43116981 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-[4-(2-amino-2-sulfanylideneethyl)phenoxy]-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)C(C)Oc1ccc(CC(N)=S)cc1 |
| InChI | InChI=1S/C15H22N2O2S/c1-10(2)9-17-15(18)11(3)19-13-6-4-12(5-7-13)8-14(16)20/h4-7,10-11H,8-9H2,1-3H3,(H2,16,20)(H,17,18) |
| InChIKey | MWBIBGWVLLQANT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|