C16H25NO4 — CID 43117629
2-[2-ethoxy-4-(hydroxymethyl)phenoxy]-N-(2-methylpropyl)propanamide (PubChem CID 43117629) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-[2-ethoxy-4-(hydroxymethyl)phenoxy]-N-(2-methylpropyl)propanamide.
| Compound Name | 2-[2-ethoxy-4-(hydroxymethyl)phenoxy]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 43117629 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[2-ethoxy-4-(hydroxymethyl)phenoxy]-N-(2-methylpropyl)propanamide |
| SMILES | CCOc1cc(CO)ccc1OC(C)C(=O)NCC(C)C |
| InChI | InChI=1S/C16H25NO4/c1-5-20-15-8-13(10-18)6-7-14(15)21-12(4)16(19)17-9-11(2)3/h6-8,11-12,18H,5,9-10H2,1-4H3,(H,17,19) |
| InChIKey | VANDOFNOSSOFCT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |