About 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione
3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione (PubChem CID 4311777) has the molecular formula C6H6N4S
and a molecular weight of 166.21 g/mol. Its IUPAC name is 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione.
Molecular Properties
| Compound Name | 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione |
| PubChem CID | 4311777 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione |
| SMILES | S=C1NCc2cncnc2N1 |
| InChI | InChI=1S/C6H6N4S/c11-6-8-2-4-1-7-3-9-5(4)10-6/h1,3H,2H2,(H2,7,8,9,10,11) |
| InChIKey | VEKYYWWMAREORV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione?
The IUPAC name of 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione (CID 4311777) is 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione.
What is the SMILES notation for 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione?
The canonical SMILES for 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione is S=C1NCc2cncnc2N1.
What is the InChIKey of 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione?
The InChIKey is VEKYYWWMAREORV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S/c11-6-8-2-4-1-7-3-9-5(4)10-6/h1,3H,2H2,(H2,7,8,9,10,11).
What are the key properties of 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione?
3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione has a molecular weight of 166.21 g/mol, XLogP of 0.28, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-1H-pyrimido[4,5-d]pyrimidine-2-thione is sourced from PubChem (CID 4311777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).