C17H25NO3 — CID 43118072
7-(2,3,5-trimethylphenoxy)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 43118072) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 7-(2,3,5-trimethylphenoxy)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | 7-(2,3,5-trimethylphenoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 43118072 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 7-(2,3,5-trimethylphenoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | Cc1cc(C)c(C)c(OC2CC3(CCC2N)OCCO3)c1 |
| InChI | InChI=1S/C17H25NO3/c1-11-8-12(2)13(3)15(9-11)21-16-10-17(5-4-14(16)18)19-6-7-20-17/h8-9,14,16H,4-7,10,18H2,1-3H3 |
| InChIKey | PELNKIPSIGWQLM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |